About as-indacene;benzene
as-indacene;benzene (PubChem CID 161093559) has the molecular formula C18H14
and a molecular weight of 230.31 g/mol. Its IUPAC name is as-indacene;benzene.
Molecular Properties
| Compound Name | as-indacene;benzene |
| PubChem CID | 161093559 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | as-indacene;benzene |
| SMILES | C1=Cc2c3c(ccc2=C1)=CC=C3.c1ccccc1 |
| InChI | InChI=1S/C12H8.C6H6/c1-3-9-7-8-10-4-2-6-12(10)11(9)5-1;1-2-4-6-5-3-1/h1-8H;1-6H |
| InChIKey | UHMMISSOGDTPMZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze as-indacene;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of as-indacene;benzene?
The IUPAC name of as-indacene;benzene (CID 161093559) is as-indacene;benzene.
What is the SMILES notation for as-indacene;benzene?
The canonical SMILES for as-indacene;benzene is C1=Cc2c3c(ccc2=C1)=CC=C3.c1ccccc1.
What is the InChIKey of as-indacene;benzene?
The InChIKey is UHMMISSOGDTPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C6H6/c1-3-9-7-8-10-4-2-6-12(10)11(9)5-1;1-2-4-6-5-3-1/h1-8H;1-6H.
What are the key properties of as-indacene;benzene?
as-indacene;benzene has a molecular weight of 230.31 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for as-indacene;benzene is sourced from PubChem (CID 161093559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).