About CID 161101027
CID 161101027 (PubChem CID 161101027) has the molecular formula C39H63BN3O12P
and a molecular weight of 807.73 g/mol.
Molecular Properties
| Compound Name | CID 161101027 |
| PubChem CID | 161101027 |
| Molecular Formula | C39H63BN3O12P |
| Molecular Weight | 807.73 g/mol |
| Exact Mass | 807.42 |
| IUPAC Name | — |
| SMILES | [B]P(C)C(=O)CCC(=O)C(CC(C)C)NC(=O)CCC(=O)CCC(NC(=O)CCC(=O)COCCOC)C(=O)CCC(=O)NC(CC(C)C)C(=O)CCC(C)=O |
| InChI | InChI=1S/C39H63BN3O12P/c1-25(2)22-31(34(48)13-8-27(5)44)43-38(52)18-14-33(47)30(41-36(50)17-11-29(46)24-55-21-20-54-6)12-9-28(45)10-16-37(51)42-32(23-26(3)4)35(49)15-19-39(53)56(7)40/h25-26,30-32H,8-24H2,1-7H3,(H,41,50)(H,42,51)(H,43,52) |
| InChIKey | FLRGPDFIDJGYSK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 225.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 807.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 161101027 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161101027?
The IUPAC name of CID 161101027 (CID 161101027) is not available.
What is the SMILES notation for CID 161101027?
The canonical SMILES for CID 161101027 is [B]P(C)C(=O)CCC(=O)C(CC(C)C)NC(=O)CCC(=O)CCC(NC(=O)CCC(=O)COCCOC)C(=O)CCC(=O)NC(CC(C)C)C(=O)CCC(C)=O.
What is the InChIKey of CID 161101027?
The InChIKey is FLRGPDFIDJGYSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H63BN3O12P/c1-25(2)22-31(34(48)13-8-27(5)44)43-38(52)18-14-33(47)30(41-36(50)17-11-29(46)24-55-21-20-54-6)12-9-28(45)10-16-37(51)42-32(23-26(3)4)35(49)15-19-39(53)56(7)40/h25-26,30-32H,8-24H2,1-7H3,(H,41,50)(H,42,51)(H,43,52).
What are the key properties of CID 161101027?
CID 161101027 has a molecular weight of 807.73 g/mol, XLogP of 3.03, 34 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161101027 is sourced from PubChem (CID 161101027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).