C26H45K2N2O9+ — CID 165079312
dipotassium;N-(3,6-dioxooctan-4-yl)-8-(2-methoxyethoxy)-4-[[4-(2-methoxyethoxy)-3-oxobutyl]amino]-5-oxooctanamide (PubChem CID 165079312) has the molecular formula C26H45K2N2O9+ and a molecular weight of 607.85 g/mol. Its IUPAC name is dipotassium;N-(3,6-dioxooctan-4-yl)-8-(2-methoxyethoxy)-4-[[4-(2-methoxyethoxy)-3-oxobutyl]amino]-5-oxooctanamide.
| Compound Name | dipotassium;N-(3,6-dioxooctan-4-yl)-8-(2-methoxyethoxy)-4-[[4-(2-methoxyethoxy)-3-oxobutyl]amino]-5-oxooctanamide |
|---|---|
| PubChem CID | 165079312 |
| Molecular Formula | C26H45K2N2O9+ |
| Molecular Weight | 607.85 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | dipotassium;N-(3,6-dioxooctan-4-yl)-8-(2-methoxyethoxy)-4-[[4-(2-methoxyethoxy)-3-oxobutyl]amino]-5-oxooctanamide |
| SMILES | [CH2-]CC(=O)CC(NC(=O)CCC(NCCC(=O)COCCOC)C(=O)CCCOCCOC)C(=O)CC.[K+].[K+] |
| InChI | InChI=1S/C26H45N2O9.2K/c1-5-20(29)18-23(24(31)6-2)28-26(33)10-9-22(25(32)8-7-13-36-16-14-34-3)27-12-11-21(30)19-37-17-15-35-4;;/h22-23,27H,1,5-19H2,2-4H3,(H,28,33);;/q-1;2*+1 |
| InChIKey | MQCTYWBLJYMPAK-UHFFFAOYSA-N |
| XLogP | -4.99 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.85 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|