C45H53N2+ — CID 161103119
5,6,9,12,12,13,13-heptamethyl-10-phenyl-16-[2,4,6-tri(propan-2-yl)phenyl]-19-aza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,8,10,14,16-octaene (PubChem CID 161103119) has the molecular formula C45H53N2+ and a molecular weight of 621.93 g/mol. Its IUPAC name is 5,6,9,12,12,13,13-heptamethyl-10-phenyl-16-[2,4,6-tri(propan-2-yl)phenyl]-19-aza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,8,10,14,16-octaene.
| Compound Name | 5,6,9,12,12,13,13-heptamethyl-10-phenyl-16-[2,4,6-tri(propan-2-yl)phenyl]-19-aza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,8,10,14,16-octaene |
|---|---|
| PubChem CID | 161103119 |
| Molecular Formula | C45H53N2+ |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | 5,6,9,12,12,13,13-heptamethyl-10-phenyl-16-[2,4,6-tri(propan-2-yl)phenyl]-19-aza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,8,10,14,16-octaene |
| SMILES | Cc1ccc2c3cc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc4c3n3c(c(-c5ccccc5)[n+](C)c3c2c1C)C(C)(C)C4(C)C |
| InChI | InChI=1S/C45H53N2/c1-25(2)31-21-34(26(3)4)39(35(22-31)27(5)6)32-23-36-33-20-19-28(7)29(8)38(33)43-46(13)40(30-17-15-14-16-18-30)42-45(11,12)44(9,10)37(24-32)41(36)47(42)43/h14-27H,1-13H3/q+1 |
| InChIKey | NBILPBPWTBBDFS-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|