C35H28O5S — CID 161104122
3-(4-methoxyphenyl)-3-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]-2H-inden-1-one (PubChem CID 161104122) has the molecular formula C35H28O5S and a molecular weight of 560.67 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]-2H-inden-1-one.
| Compound Name | 3-(4-methoxyphenyl)-3-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]-2H-inden-1-one |
|---|---|
| PubChem CID | 161104122 |
| Molecular Formula | C35H28O5S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-3-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]-2H-inden-1-one |
| SMILES | COc1ccc(C2(c3ccc(Oc4ccc(S(=O)(=O)c5ccc(C)cc5)cc4)cc3)CC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C35H28O5S/c1-24-7-19-30(20-8-24)41(37,38)31-21-17-29(18-22-31)40-28-15-11-26(12-16-28)35(25-9-13-27(39-2)14-10-25)23-34(36)32-5-3-4-6-33(32)35/h3-22H,23H2,1-2H3 |
| InChIKey | SSOLNNGEXBLKRL-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |