C38H35FN2O12S2 — CID 161104154
ethane-1,2-diol;1-[(5-fluoro-2-nitrophenyl)methylsulfonyl]naphthalene;2-[3-(naphthalen-1-ylsulfonylmethyl)-4-nitrophenoxy]ethanol (PubChem CID 161104154) has the molecular formula C38H35FN2O12S2 and a molecular weight of 794.83 g/mol. Its IUPAC name is ethane-1,2-diol;1-[(5-fluoro-2-nitrophenyl)methylsulfonyl]naphthalene;2-[3-(naphthalen-1-ylsulfonylmethyl)-4-nitrophenoxy]ethanol.
| Compound Name | ethane-1,2-diol;1-[(5-fluoro-2-nitrophenyl)methylsulfonyl]naphthalene;2-[3-(naphthalen-1-ylsulfonylmethyl)-4-nitrophenoxy]ethanol |
|---|---|
| PubChem CID | 161104154 |
| Molecular Formula | C38H35FN2O12S2 |
| Molecular Weight | 794.83 g/mol |
| Exact Mass | 794.16 |
| IUPAC Name | ethane-1,2-diol;1-[(5-fluoro-2-nitrophenyl)methylsulfonyl]naphthalene;2-[3-(naphthalen-1-ylsulfonylmethyl)-4-nitrophenoxy]ethanol |
| SMILES | O=[N+]([O-])c1ccc(F)cc1CS(=O)(=O)c1cccc2ccccc12.O=[N+]([O-])c1ccc(OCCO)cc1CS(=O)(=O)c1cccc2ccccc12.OCCO |
| InChI | InChI=1S/C19H17NO6S.C17H12FNO4S.C2H6O2/c21-10-11-26-16-8-9-18(20(22)23)15(12-16)13-27(24,25)19-7-3-5-14-4-1-2-6-17(14)19;18-14-8-9-16(19(20)21)13(10-14)11-24(22,23)17-7-3-5-12-4-1-2-6-15(12)17;3-1-2-4/h1-9,12,21H,10-11,13H2;1-10H,11H2;3-4H,1-2H2 |
| InChIKey | UIVBBFWQWQHKTH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 224.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.83 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|