C36H49F2N3O7 — CID 161104417
tert-butyl 4-(2-fluoro-6-formylphenyl)piperidine-1-carboxylate;tert-butyl 4-[2-fluoro-6-[methoxy(methyl)carbamoyl]phenyl]piperidine-1-carboxylate (PubChem CID 161104417) has the molecular formula C36H49F2N3O7 and a molecular weight of 673.80 g/mol. Its IUPAC name is tert-butyl 4-(2-fluoro-6-formylphenyl)piperidine-1-carboxylate;tert-butyl 4-[2-fluoro-6-[methoxy(methyl)carbamoyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-fluoro-6-formylphenyl)piperidine-1-carboxylate;tert-butyl 4-[2-fluoro-6-[methoxy(methyl)carbamoyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161104417 |
| Molecular Formula | C36H49F2N3O7 |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 673.35 |
| IUPAC Name | tert-butyl 4-(2-fluoro-6-formylphenyl)piperidine-1-carboxylate;tert-butyl 4-[2-fluoro-6-[methoxy(methyl)carbamoyl]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2c(F)cccc2C=O)CC1.CON(C)C(=O)c1cccc(F)c1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27FN2O4.C17H22FNO3/c1-19(2,3)26-18(24)22-11-9-13(10-12-22)16-14(7-6-8-15(16)20)17(23)21(4)25-5;1-17(2,3)22-16(21)19-9-7-12(8-10-19)15-13(11-20)5-4-6-14(15)18/h6-8,13H,9-12H2,1-5H3;4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | UIVXVITWHOIQDL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.80 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|