C28H29Cl2N5O3 — CID 161104894
(2R)-1-[2,4-dichloro-3-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]phenoxy]pentan-2-ol (PubChem CID 161104894) has the molecular formula C28H29Cl2N5O3 and a molecular weight of 554.48 g/mol. Its IUPAC name is (2R)-1-[2,4-dichloro-3-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]phenoxy]pentan-2-ol.
| Compound Name | (2R)-1-[2,4-dichloro-3-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]phenoxy]pentan-2-ol |
|---|---|
| PubChem CID | 161104894 |
| Molecular Formula | C28H29Cl2N5O3 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (2R)-1-[2,4-dichloro-3-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-2-yl]phenoxy]pentan-2-ol |
| SMILES | CCC[C@@H](O)COc1ccc(Cl)c(-c2nc(-c3c(C)noc3C)c(C)c(N3Cc4cccnc4C3)n2)c1Cl |
| InChI | InChI=1S/C28H29Cl2N5O3/c1-5-7-19(36)14-37-22-10-9-20(29)24(25(22)30)27-32-26(23-16(3)34-38-17(23)4)15(2)28(33-27)35-12-18-8-6-11-31-21(18)13-35/h6,8-11,19,36H,5,7,12-14H2,1-4H3/t19-/m1/s1 |
| InChIKey | UIXNPRGBJYPZHS-LJQANCHMSA-N |
| XLogP | 6.49 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |