C43H54N2O2 — CID 161106850
tert-butyl N-(5-methyl-2,2-diphenylhex-4-enyl)carbamate;5-methyl-2,2-diphenylhex-4-en-1-amine (PubChem CID 161106850) has the molecular formula C43H54N2O2 and a molecular weight of 630.92 g/mol. Its IUPAC name is tert-butyl N-(5-methyl-2,2-diphenylhex-4-enyl)carbamate;5-methyl-2,2-diphenylhex-4-en-1-amine.
| Compound Name | tert-butyl N-(5-methyl-2,2-diphenylhex-4-enyl)carbamate;5-methyl-2,2-diphenylhex-4-en-1-amine |
|---|---|
| PubChem CID | 161106850 |
| Molecular Formula | C43H54N2O2 |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.42 |
| IUPAC Name | tert-butyl N-(5-methyl-2,2-diphenylhex-4-enyl)carbamate;5-methyl-2,2-diphenylhex-4-en-1-amine |
| SMILES | CC(C)=CCC(CN)(c1ccccc1)c1ccccc1.CC(C)=CCC(CNC(=O)OC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2.C19H23N/c1-19(2)16-17-24(20-12-8-6-9-13-20,21-14-10-7-11-15-21)18-25-22(26)27-23(3,4)5;1-16(2)13-14-19(15-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h6-16H,17-18H2,1-5H3,(H,25,26);3-13H,14-15,20H2,1-2H3 |
| InChIKey | UJDVJDGBFIYYRM-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|