About trimagnesium;guanidine;diphosphate
trimagnesium;guanidine;diphosphate (PubChem CID 161111260) has the molecular formula CH5Mg3N3O8P2
and a molecular weight of 321.93 g/mol. Its IUPAC name is trimagnesium;guanidine;diphosphate.
Molecular Properties
| Compound Name | trimagnesium;guanidine;diphosphate |
| PubChem CID | 161111260 |
| Molecular Formula | CH5Mg3N3O8P2 |
| Molecular Weight | 321.93 g/mol |
| Exact Mass | 320.91 |
| IUPAC Name | trimagnesium;guanidine;diphosphate |
| SMILES | O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[H]N=C(N)N.[Mg+2].[Mg+2].[Mg+2] |
| InChI | InChI=1S/CH5N3.3Mg.2H3O4P/c2-1(3)4;;;;2*1-5(2,3)4/h(H5,2,3,4);;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6 |
| InChIKey | UJSKMDMMQHFQGL-UHFFFAOYSA-H |
| XLogP | -7.95 |
| TPSA | 248.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.93 |
| LogP ≤ 5 | -7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trimagnesium;guanidine;diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimagnesium;guanidine;diphosphate?
The IUPAC name of trimagnesium;guanidine;diphosphate (CID 161111260) is trimagnesium;guanidine;diphosphate.
What is the SMILES notation for trimagnesium;guanidine;diphosphate?
The canonical SMILES for trimagnesium;guanidine;diphosphate is O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[H]N=C(N)N.[Mg+2].[Mg+2].[Mg+2].
What is the InChIKey of trimagnesium;guanidine;diphosphate?
The InChIKey is UJSKMDMMQHFQGL-UHFFFAOYSA-H. The full InChI is InChI=1S/CH5N3.3Mg.2H3O4P/c2-1(3)4;;;;2*1-5(2,3)4/h(H5,2,3,4);;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6.
What are the key properties of trimagnesium;guanidine;diphosphate?
trimagnesium;guanidine;diphosphate has a molecular weight of 321.93 g/mol, XLogP of -7.95, 0 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for trimagnesium;guanidine;diphosphate is sourced from PubChem (CID 161111260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).