C29H24F2N4O — CID 161112568
4-(7-fluoro-4-isocyanato-2,3-dihydro-1H-inden-5-yl)pyridine;7-fluoro-5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine (PubChem CID 161112568) has the molecular formula C29H24F2N4O and a molecular weight of 482.53 g/mol. Its IUPAC name is 4-(7-fluoro-4-isocyanato-2,3-dihydro-1H-inden-5-yl)pyridine;7-fluoro-5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 4-(7-fluoro-4-isocyanato-2,3-dihydro-1H-inden-5-yl)pyridine;7-fluoro-5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 161112568 |
| Molecular Formula | C29H24F2N4O |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 4-(7-fluoro-4-isocyanato-2,3-dihydro-1H-inden-5-yl)pyridine;7-fluoro-5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1c(-c2ccncc2)cc(F)c2c1CCC2.O=C=Nc1c(-c2ccncc2)cc(F)c2c1CCC2 |
| InChI | InChI=1S/C15H11FN2O.C14H13FN2/c16-14-8-13(10-4-6-17-7-5-10)15(18-9-19)12-3-1-2-11(12)14;15-13-8-12(9-4-6-17-7-5-9)14(16)11-3-1-2-10(11)13/h4-8H,1-3H2;4-8H,1-3,16H2 |
| InChIKey | UJWSNEAOKQVQAO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|