C16H12N4O3 — CID 161113178
N-hydroxy-3-[(5-isocyano-6-methyl-1H-benzimidazol-2-yl)oxy]benzamide (PubChem CID 161113178) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-hydroxy-3-[(5-isocyano-6-methyl-1H-benzimidazol-2-yl)oxy]benzamide.
| Compound Name | N-hydroxy-3-[(5-isocyano-6-methyl-1H-benzimidazol-2-yl)oxy]benzamide |
|---|---|
| PubChem CID | 161113178 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-hydroxy-3-[(5-isocyano-6-methyl-1H-benzimidazol-2-yl)oxy]benzamide |
| SMILES | [C-]#[N+]c1cc2nc(Oc3cccc(C(=O)NO)c3)[nH]c2cc1C |
| InChI | InChI=1S/C16H12N4O3/c1-9-6-13-14(8-12(9)17-2)19-16(18-13)23-11-5-3-4-10(7-11)15(21)20-22/h3-8,22H,1H3,(H,18,19)(H,20,21) |
| InChIKey | SXUUSZRWGLUNBB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|