C17H11F3N4O2 — CID 166595572
3-[[6-ethynyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide (PubChem CID 166595572) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 3-[[6-ethynyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide.
| Compound Name | 3-[[6-ethynyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 166595572 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-[[6-ethynyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide |
| SMILES | C#Cc1cc2[nH]c(Nc3cccc(C(=O)NO)c3)nc2cc1C(F)(F)F |
| InChI | InChI=1S/C17H11F3N4O2/c1-2-9-7-13-14(8-12(9)17(18,19)20)23-16(22-13)21-11-5-3-4-10(6-11)15(25)24-26/h1,3-8,26H,(H,24,25)(H2,21,22,23) |
| InChIKey | WYZSLVFBQKVLNE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|