C17H11F3N4O2 — CID 134492557
3-[[6-cyano-1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]amino]benzoic acid (PubChem CID 134492557) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 3-[[6-cyano-1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]amino]benzoic acid.
| Compound Name | 3-[[6-cyano-1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 134492557 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-[[6-cyano-1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]amino]benzoic acid |
| SMILES | Cn1c(Nc2cccc(C(=O)O)c2)nc2cc(C(F)(F)F)c(C#N)cc21 |
| InChI | InChI=1S/C17H11F3N4O2/c1-24-14-6-10(8-21)12(17(18,19)20)7-13(14)23-16(24)22-11-4-2-3-9(5-11)15(25)26/h2-7H,1H3,(H,22,23)(H,25,26) |
| InChIKey | ZPAZTQSUTGZHRZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |