C26H31F3N6O4 — CID 134459841
tert-butyl N-[5-[5-cyano-2-[3-[hydroxy-(hydroxyamino)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate (PubChem CID 134459841) has the molecular formula C26H31F3N6O4 and a molecular weight of 548.57 g/mol. Its IUPAC name is tert-butyl N-[5-[5-cyano-2-[3-[hydroxy-(hydroxyamino)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[5-cyano-2-[3-[hydroxy-(hydroxyamino)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 134459841 |
| Molecular Formula | C26H31F3N6O4 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | tert-butyl N-[5-[5-cyano-2-[3-[hydroxy-(hydroxyamino)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCn1c(Nc2cccc(C(O)NO)c2)nc2cc(C#N)c(C(F)(F)F)cc21 |
| InChI | InChI=1S/C26H31F3N6O4/c1-25(2,3)39-24(37)31-10-5-4-6-11-35-21-14-19(26(27,28)29)17(15-30)13-20(21)33-23(35)32-18-9-7-8-16(12-18)22(36)34-38/h7-9,12-14,22,34,36,38H,4-6,10-11H2,1-3H3,(H,31,37)(H,32,33) |
| InChIKey | XUKPQHMZWCRZFW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|