C27H32F3N5O4 — CID 134459835
tert-butyl N-[5-[5-cyano-2-[3-[hydroxy(methoxy)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate (PubChem CID 134459835) has the molecular formula C27H32F3N5O4 and a molecular weight of 547.58 g/mol. Its IUPAC name is tert-butyl N-[5-[5-cyano-2-[3-[hydroxy(methoxy)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[5-cyano-2-[3-[hydroxy(methoxy)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 134459835 |
| Molecular Formula | C27H32F3N5O4 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | tert-butyl N-[5-[5-cyano-2-[3-[hydroxy(methoxy)methyl]anilino]-6-(trifluoromethyl)benzimidazol-1-yl]pentyl]carbamate |
| SMILES | COC(O)c1cccc(Nc2nc3cc(C#N)c(C(F)(F)F)cc3n2CCCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H32F3N5O4/c1-26(2,3)39-25(37)32-11-6-5-7-12-35-22-15-20(27(28,29)30)18(16-31)14-21(22)34-24(35)33-19-10-8-9-17(13-19)23(36)38-4/h8-10,13-15,23,36H,5-7,11-12H2,1-4H3,(H,32,37)(H,33,34) |
| InChIKey | BJIQTIOGAOOUGX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|