C19H16F3N5O3 — CID 134459646
3-[[6-cyano-1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide (PubChem CID 134459646) has the molecular formula C19H16F3N5O3 and a molecular weight of 419.36 g/mol. Its IUPAC name is 3-[[6-cyano-1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide.
| Compound Name | 3-[[6-cyano-1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 134459646 |
| Molecular Formula | C19H16F3N5O3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[[6-cyano-1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide |
| SMILES | COCCn1c(Nc2cccc(C(=O)NO)c2)nc2cc(C(F)(F)F)c(C#N)cc21 |
| InChI | InChI=1S/C19H16F3N5O3/c1-30-6-5-27-16-8-12(10-23)14(19(20,21)22)9-15(16)25-18(27)24-13-4-2-3-11(7-13)17(28)26-29/h2-4,7-9,29H,5-6H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | ONCXDYXOPAYDRJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|