C15H10BrF3N4O2 — CID 134459673
3-[[5-bromo-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide (PubChem CID 134459673) has the molecular formula C15H10BrF3N4O2 and a molecular weight of 415.17 g/mol. Its IUPAC name is 3-[[5-bromo-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide.
| Compound Name | 3-[[5-bromo-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 134459673 |
| Molecular Formula | C15H10BrF3N4O2 |
| Molecular Weight | 415.17 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 3-[[5-bromo-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1cccc(Nc2nc3cc(Br)c(C(F)(F)F)cc3[nH]2)c1 |
| InChI | InChI=1S/C15H10BrF3N4O2/c16-10-6-12-11(5-9(10)15(17,18)19)21-14(22-12)20-8-3-1-2-7(4-8)13(24)23-25/h1-6,25H,(H,23,24)(H2,20,21,22) |
| InChIKey | MRSVFRJEBGXVOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|