C20H14F3N5O2 — CID 134459699
N-hydroxy-3-[[5-pyridin-4-yl-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]benzamide (PubChem CID 134459699) has the molecular formula C20H14F3N5O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is N-hydroxy-3-[[5-pyridin-4-yl-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]benzamide.
| Compound Name | N-hydroxy-3-[[5-pyridin-4-yl-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 134459699 |
| Molecular Formula | C20H14F3N5O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-hydroxy-3-[[5-pyridin-4-yl-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]benzamide |
| SMILES | O=C(NO)c1cccc(Nc2nc3cc(-c4ccncc4)c(C(F)(F)F)cc3[nH]2)c1 |
| InChI | InChI=1S/C20H14F3N5O2/c21-20(22,23)15-10-17-16(9-14(15)11-4-6-24-7-5-11)26-19(27-17)25-13-3-1-2-12(8-13)18(29)28-30/h1-10,30H,(H,28,29)(H2,25,26,27) |
| InChIKey | DBSQOKQECVFSOD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|