C24H18F3N3O4 — CID 138488589
3-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(trifluoromethyl)-1H-indol-2-yl]amino]-N-hydroxybenzamide (PubChem CID 138488589) has the molecular formula C24H18F3N3O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is 3-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(trifluoromethyl)-1H-indol-2-yl]amino]-N-hydroxybenzamide.
| Compound Name | 3-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(trifluoromethyl)-1H-indol-2-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 138488589 |
| Molecular Formula | C24H18F3N3O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 3-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(trifluoromethyl)-1H-indol-2-yl]amino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1cccc(Nc2cc3cc(C(F)(F)F)c(-c4ccc5c(c4)OCCO5)cc3[nH]2)c1 |
| InChI | InChI=1S/C24H18F3N3O4/c25-24(26,27)18-9-15-11-22(28-16-3-1-2-14(8-16)23(31)30-32)29-19(15)12-17(18)13-4-5-20-21(10-13)34-7-6-33-20/h1-5,8-12,28-29,32H,6-7H2,(H,30,31) |
| InChIKey | RPTALNVUTLYBKC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|