C24H20F3N3O3 — CID 157139900
N-hydroxy-3-[[5-[3-(methoxymethyl)phenyl]-6-(trifluoromethyl)-3H-indol-2-yl]amino]benzamide (PubChem CID 157139900) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-hydroxy-3-[[5-[3-(methoxymethyl)phenyl]-6-(trifluoromethyl)-3H-indol-2-yl]amino]benzamide.
| Compound Name | N-hydroxy-3-[[5-[3-(methoxymethyl)phenyl]-6-(trifluoromethyl)-3H-indol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 157139900 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-hydroxy-3-[[5-[3-(methoxymethyl)phenyl]-6-(trifluoromethyl)-3H-indol-2-yl]amino]benzamide |
| SMILES | COCc1cccc(-c2cc3c(cc2C(F)(F)F)N=C(Nc2cccc(C(=O)NO)c2)C3)c1 |
| InChI | InChI=1S/C24H20F3N3O3/c1-33-13-14-4-2-5-15(8-14)19-10-17-11-22(29-21(17)12-20(19)24(25,26)27)28-18-7-3-6-16(9-18)23(31)30-32/h2-10,12,32H,11,13H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | AKBNGDRWWGKOLJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|