C16H14BrN3O2 — CID 149003619
3-[(6-bromo-5-methyl-3H-indol-2-yl)amino]-N-hydroxybenzamide (PubChem CID 149003619) has the molecular formula C16H14BrN3O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is 3-[(6-bromo-5-methyl-3H-indol-2-yl)amino]-N-hydroxybenzamide.
| Compound Name | 3-[(6-bromo-5-methyl-3H-indol-2-yl)amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 149003619 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 3-[(6-bromo-5-methyl-3H-indol-2-yl)amino]-N-hydroxybenzamide |
| SMILES | Cc1cc2c(cc1Br)N=C(Nc1cccc(C(=O)NO)c1)C2 |
| InChI | InChI=1S/C16H14BrN3O2/c1-9-5-11-7-15(19-14(11)8-13(9)17)18-12-4-2-3-10(6-12)16(21)20-22/h2-6,8,22H,7H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | QADLKYJUXHTHGH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|