C23H25F3N4O3 — CID 151923051
tert-butyl N-[3-[3-anilino-4-oxo-5-(trifluoromethyl)quinazolin-2-yl]propyl]carbamate (PubChem CID 151923051) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is tert-butyl N-[3-[3-anilino-4-oxo-5-(trifluoromethyl)quinazolin-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-anilino-4-oxo-5-(trifluoromethyl)quinazolin-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 151923051 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | tert-butyl N-[3-[3-anilino-4-oxo-5-(trifluoromethyl)quinazolin-2-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1nc2cccc(C(F)(F)F)c2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C23H25F3N4O3/c1-22(2,3)33-21(32)27-14-8-13-18-28-17-12-7-11-16(23(24,25)26)19(17)20(31)30(18)29-15-9-5-4-6-10-15/h4-7,9-12,29H,8,13-14H2,1-3H3,(H,27,32) |
| InChIKey | SXDZZEYIOKWZIV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|