C21H21ClN4O3 — CID 144566834
tert-butyl (NZ)-N-[1-(3-anilino-5-chloro-4-oxoquinazolin-2-yl)ethylidene]carbamate (PubChem CID 144566834) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[1-(3-anilino-5-chloro-4-oxoquinazolin-2-yl)ethylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[1-(3-anilino-5-chloro-4-oxoquinazolin-2-yl)ethylidene]carbamate |
|---|---|
| PubChem CID | 144566834 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | tert-butyl (NZ)-N-[1-(3-anilino-5-chloro-4-oxoquinazolin-2-yl)ethylidene]carbamate |
| SMILES | C/C(=N/C(=O)OC(C)(C)C)c1nc2cccc(Cl)c2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C21H21ClN4O3/c1-13(23-20(28)29-21(2,3)4)18-24-16-12-8-11-15(22)17(16)19(27)26(18)25-14-9-6-5-7-10-14/h5-12,25H,1-4H3/b23-13- |
| InChIKey | LDDKSPQTCUQOBP-QRVIBDJDSA-N |
| XLogP | 4.67 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|