C18H20F4N2O3 — CID 68891708
tert-butyl N-[2-[2-acetyl-5-fluoro-6-(trifluoromethyl)indol-1-yl]ethyl]carbamate (PubChem CID 68891708) has the molecular formula C18H20F4N2O3 and a molecular weight of 388.36 g/mol. Its IUPAC name is tert-butyl N-[2-[2-acetyl-5-fluoro-6-(trifluoromethyl)indol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-acetyl-5-fluoro-6-(trifluoromethyl)indol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 68891708 |
| Molecular Formula | C18H20F4N2O3 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | tert-butyl N-[2-[2-acetyl-5-fluoro-6-(trifluoromethyl)indol-1-yl]ethyl]carbamate |
| SMILES | CC(=O)c1cc2cc(F)c(C(F)(F)F)cc2n1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H20F4N2O3/c1-10(25)14-8-11-7-13(19)12(18(20,21)22)9-15(11)24(14)6-5-23-16(26)27-17(2,3)4/h7-9H,5-6H2,1-4H3,(H,23,26) |
| InChIKey | VNVBGFQANAJHGM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |