C21H21N3O3 — CID 161113640
2-(2-amino-2-oxoethyl)-6-(4-phenylbutanoyl)-1H-indole-3-carboxamide (PubChem CID 161113640) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)-6-(4-phenylbutanoyl)-1H-indole-3-carboxamide.
| Compound Name | 2-(2-amino-2-oxoethyl)-6-(4-phenylbutanoyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 161113640 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)-6-(4-phenylbutanoyl)-1H-indole-3-carboxamide |
| SMILES | NC(=O)Cc1[nH]c2cc(C(=O)CCCc3ccccc3)ccc2c1C(N)=O |
| InChI | InChI=1S/C21H21N3O3/c22-19(26)12-17-20(21(23)27)15-10-9-14(11-16(15)24-17)18(25)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-11,24H,4,7-8,12H2,(H2,22,26)(H2,23,27) |
| InChIKey | UKAIGYSQHKQHPN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |