C19H11F6NO — CID 161113936
6-phenyl-4-(trifluoromethyl)-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one (PubChem CID 161113936) has the molecular formula C19H11F6NO and a molecular weight of 383.29 g/mol. Its IUPAC name is 6-phenyl-4-(trifluoromethyl)-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one.
| Compound Name | 6-phenyl-4-(trifluoromethyl)-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 161113936 |
| Molecular Formula | C19H11F6NO |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 6-phenyl-4-(trifluoromethyl)-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one |
| SMILES | O=c1cc(C(F)(F)F)cc(-c2ccccc2)n1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H11F6NO/c20-14-7-6-12(17(21)18(14)22)10-26-15(11-4-2-1-3-5-11)8-13(9-16(26)27)19(23,24)25/h1-9H,10H2 |
| InChIKey | HNXAPOUCQQAZRH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|