C15H21N4Y2- — CID 161116994
1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide;4,5,6-trimethyl-2H-pyrimidin-2-ide;bis(yttrium) (PubChem CID 161116994) has the molecular formula C15H21N4Y2- and a molecular weight of 435.17 g/mol. Its IUPAC name is 1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide;4,5,6-trimethyl-2H-pyrimidin-2-ide;bis(yttrium).
| Compound Name | 1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide;4,5,6-trimethyl-2H-pyrimidin-2-ide;bis(yttrium) |
|---|---|
| PubChem CID | 161116994 |
| Molecular Formula | C15H21N4Y2- |
| Molecular Weight | 435.17 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide;4,5,6-trimethyl-2H-pyrimidin-2-ide;bis(yttrium) |
| SMILES | Cc1n[c-][n+](C)c(C)c1C.Cc1n[c-]nc(C)c1C.[Y].[Y] |
| InChI | InChI=1S/C8H12N2.C7H9N2.2Y/c1-6-7(2)9-5-10(4)8(6)3;1-5-6(2)8-4-9-7(5)3;;/h1-4H3;1-3H3;;/q;-1;; |
| InChIKey | BSRXMFGNDWZZSS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|