C15H24N2Y-2 — CID 59882463
2,3,4-trimethylpent-2-ene;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium (PubChem CID 59882463) has the molecular formula C15H24N2Y-2 and a molecular weight of 321.28 g/mol. Its IUPAC name is 2,3,4-trimethylpent-2-ene;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium.
| Compound Name | 2,3,4-trimethylpent-2-ene;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium |
|---|---|
| PubChem CID | 59882463 |
| Molecular Formula | C15H24N2Y-2 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2,3,4-trimethylpent-2-ene;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium |
| SMILES | CC(C)=C(C)[C-](C)C.Cc1n[c-]nc(C)c1C.[Y] |
| InChI | InChI=1S/C8H15.C7H9N2.Y/c1-6(2)8(5)7(3)4;1-5-6(2)8-4-9-7(5)3;/h1-5H3;1-3H3;/q2*-1; |
| InChIKey | PVCAURMFUQQLAY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|