C30H40O12 — CID 161120744
ethyl 2-methyl-3-oxobutanoate;7-hydroxy-5-(2-methoxyethoxy)-3,4-dimethylchromen-2-one;5-(2-methoxyethoxy)benzene-1,3-diol (PubChem CID 161120744) has the molecular formula C30H40O12 and a molecular weight of 592.64 g/mol. Its IUPAC name is ethyl 2-methyl-3-oxobutanoate;7-hydroxy-5-(2-methoxyethoxy)-3,4-dimethylchromen-2-one;5-(2-methoxyethoxy)benzene-1,3-diol.
| Compound Name | ethyl 2-methyl-3-oxobutanoate;7-hydroxy-5-(2-methoxyethoxy)-3,4-dimethylchromen-2-one;5-(2-methoxyethoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 161120744 |
| Molecular Formula | C30H40O12 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | ethyl 2-methyl-3-oxobutanoate;7-hydroxy-5-(2-methoxyethoxy)-3,4-dimethylchromen-2-one;5-(2-methoxyethoxy)benzene-1,3-diol |
| SMILES | CCOC(=O)C(C)C(C)=O.COCCOc1cc(O)cc(O)c1.COCCOc1cc(O)cc2oc(=O)c(C)c(C)c12 |
| InChI | InChI=1S/C14H16O5.C9H12O4.C7H12O3/c1-8-9(2)14(16)19-12-7-10(15)6-11(13(8)12)18-5-4-17-3;1-12-2-3-13-9-5-7(10)4-8(11)6-9;1-4-10-7(9)5(2)6(3)8/h6-7,15H,4-5H2,1-3H3;4-6,10-11H,2-3H2,1H3;5H,4H2,1-3H3 |
| InChIKey | UKXKSVRVYRBFMW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 171.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|