C37H44O2 — CID 161130846
1-(3,4-dimethylphenoxy)-4-[[4-(3,4-dimethylphenoxy)-2,3,5,6-tetramethylphenyl]methyl]-2,3,5,6-tetramethylbenzene (PubChem CID 161130846) has the molecular formula C37H44O2 and a molecular weight of 520.76 g/mol. Its IUPAC name is 1-(3,4-dimethylphenoxy)-4-[[4-(3,4-dimethylphenoxy)-2,3,5,6-tetramethylphenyl]methyl]-2,3,5,6-tetramethylbenzene.
| Compound Name | 1-(3,4-dimethylphenoxy)-4-[[4-(3,4-dimethylphenoxy)-2,3,5,6-tetramethylphenyl]methyl]-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 161130846 |
| Molecular Formula | C37H44O2 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 1-(3,4-dimethylphenoxy)-4-[[4-(3,4-dimethylphenoxy)-2,3,5,6-tetramethylphenyl]methyl]-2,3,5,6-tetramethylbenzene |
| SMILES | Cc1ccc(Oc2c(C)c(C)c(Cc3c(C)c(C)c(Oc4ccc(C)c(C)c4)c(C)c3C)c(C)c2C)cc1C |
| InChI | InChI=1S/C37H44O2/c1-20-13-15-32(17-22(20)3)38-36-28(9)24(5)34(25(6)29(36)10)19-35-26(7)30(11)37(31(12)27(35)8)39-33-16-14-21(2)23(4)18-33/h13-18H,19H2,1-12H3 |
| InChIKey | MQHZOTOOESGGGY-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |