C24H32ClFN4O — CID 161131940
5-[5-chloro-2-[[4-(2-methoxyethylamino)cyclohexyl]methyl]-4-pyridinyl]-N-(cyclopropylmethyl)-2-fluoropyridin-3-amine (PubChem CID 161131940) has the molecular formula C24H32ClFN4O and a molecular weight of 447.00 g/mol. Its IUPAC name is 5-[5-chloro-2-[[4-(2-methoxyethylamino)cyclohexyl]methyl]-4-pyridinyl]-N-(cyclopropylmethyl)-2-fluoropyridin-3-amine.
| Compound Name | 5-[5-chloro-2-[[4-(2-methoxyethylamino)cyclohexyl]methyl]-4-pyridinyl]-N-(cyclopropylmethyl)-2-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 161131940 |
| Molecular Formula | C24H32ClFN4O |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 5-[5-chloro-2-[[4-(2-methoxyethylamino)cyclohexyl]methyl]-4-pyridinyl]-N-(cyclopropylmethyl)-2-fluoropyridin-3-amine |
| SMILES | COCCNC1CCC(Cc2cc(-c3cnc(F)c(NCC4CC4)c3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C24H32ClFN4O/c1-31-9-8-27-19-6-4-16(5-7-19)10-20-12-21(22(25)15-28-20)18-11-23(24(26)30-14-18)29-13-17-2-3-17/h11-12,14-17,19,27,29H,2-10,13H2,1H3 |
| InChIKey | UMHOPPTYUGQJMI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|