C23H30Cl2N4O — CID 148553276
5-[2-[(4-aminocyclohexyl)methyl]-5-chloro-4-pyridinyl]-2-chloro-N-(oxan-4-ylmethyl)pyridin-3-amine (PubChem CID 148553276) has the molecular formula C23H30Cl2N4O and a molecular weight of 449.43 g/mol. Its IUPAC name is 5-[2-[(4-aminocyclohexyl)methyl]-5-chloro-4-pyridinyl]-2-chloro-N-(oxan-4-ylmethyl)pyridin-3-amine.
| Compound Name | 5-[2-[(4-aminocyclohexyl)methyl]-5-chloro-4-pyridinyl]-2-chloro-N-(oxan-4-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 148553276 |
| Molecular Formula | C23H30Cl2N4O |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5-[2-[(4-aminocyclohexyl)methyl]-5-chloro-4-pyridinyl]-2-chloro-N-(oxan-4-ylmethyl)pyridin-3-amine |
| SMILES | NC1CCC(Cc2cc(-c3cnc(Cl)c(NCC4CCOCC4)c3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C23H30Cl2N4O/c24-21-14-27-19(9-15-1-3-18(26)4-2-15)11-20(21)17-10-22(23(25)29-13-17)28-12-16-5-7-30-8-6-16/h10-11,13-16,18,28H,1-9,12,26H2 |
| InChIKey | MTOQAEHQPMOHNM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|