C16H34N2O6 — CID 161133632
tert-butyl N-[2-(2-methoxyethylamino)ethoxy]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane (PubChem CID 161133632) has the molecular formula C16H34N2O6 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl N-[2-(2-methoxyethylamino)ethoxy]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane.
| Compound Name | tert-butyl N-[2-(2-methoxyethylamino)ethoxy]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane |
|---|---|
| PubChem CID | 161133632 |
| Molecular Formula | C16H34N2O6 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | tert-butyl N-[2-(2-methoxyethylamino)ethoxy]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane |
| SMILES | C.COCCNCCON(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O6.CH4/c1-14(2,3)22-12(18)17(13(19)23-15(4,5)6)21-11-9-16-8-10-20-7;/h16H,8-11H2,1-7H3;1H4 |
| InChIKey | UMMZTVHIGWGXRQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|