C28H44F8N2O8S2 — CID 161136273
N-[2-[2-[2-(butanethioylamino)ethoxy]ethoxy]ethyl]-2-[2-[1,1-difluoro-2-oxo-5-[2-(4-sulfanylideneheptoxy)ethoxy]pentoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetamide (PubChem CID 161136273) has the molecular formula C28H44F8N2O8S2 and a molecular weight of 752.78 g/mol. Its IUPAC name is N-[2-[2-[2-(butanethioylamino)ethoxy]ethoxy]ethyl]-2-[2-[1,1-difluoro-2-oxo-5-[2-(4-sulfanylideneheptoxy)ethoxy]pentoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetamide.
| Compound Name | N-[2-[2-[2-(butanethioylamino)ethoxy]ethoxy]ethyl]-2-[2-[1,1-difluoro-2-oxo-5-[2-(4-sulfanylideneheptoxy)ethoxy]pentoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 161136273 |
| Molecular Formula | C28H44F8N2O8S2 |
| Molecular Weight | 752.78 g/mol |
| Exact Mass | 752.24 |
| IUPAC Name | N-[2-[2-[2-(butanethioylamino)ethoxy]ethoxy]ethyl]-2-[2-[1,1-difluoro-2-oxo-5-[2-(4-sulfanylideneheptoxy)ethoxy]pentoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetamide |
| SMILES | CCCC(=S)CCCOCCOCCCC(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(=O)NCCOCCOCCNC(=S)CCC |
| InChI | InChI=1S/C28H44F8N2O8S2/c1-3-7-21(47)9-5-13-41-17-18-42-14-6-10-22(39)25(29,30)45-27(33,34)28(35,36)46-26(31,32)24(40)38-12-16-44-20-19-43-15-11-37-23(48)8-4-2/h3-20H2,1-2H3,(H,37,48)(H,38,40) |
| InChIKey | UMVMNUAKIOBCRL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|