C24H35NO — CID 161142847
3,5,5-trimethyl-1-(1-propan-2-yl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)hexan-1-one (PubChem CID 161142847) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-(1-propan-2-yl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)hexan-1-one.
| Compound Name | 3,5,5-trimethyl-1-(1-propan-2-yl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 161142847 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 3,5,5-trimethyl-1-(1-propan-2-yl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)hexan-1-one |
| SMILES | CC(CC(=O)N1CCC2=C(Cc3ccccc32)C1C(C)C)CC(C)(C)C |
| InChI | InChI=1S/C24H35NO/c1-16(2)23-21-14-18-9-7-8-10-19(18)20(21)11-12-25(23)22(26)13-17(3)15-24(4,5)6/h7-10,16-17,23H,11-15H2,1-6H3 |
| InChIKey | MVSGHBGWHHMPBN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |