C25H36N2O3 — CID 160667487
tert-butyl N-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-4-oxobutyl]carbamate (PubChem CID 160667487) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 160667487 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | tert-butyl N-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl]-4-oxobutyl]carbamate |
| SMILES | CC(C)CC1C2=C(CCN1C(=O)CCCNC(=O)OC(C)(C)C)c1ccccc1C2 |
| InChI | InChI=1S/C25H36N2O3/c1-17(2)15-22-21-16-18-9-6-7-10-19(18)20(21)12-14-27(22)23(28)11-8-13-26-24(29)30-25(3,4)5/h6-7,9-10,17,22H,8,11-16H2,1-5H3,(H,26,29) |
| InChIKey | FZOVGJJXCZHXNV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|