C26H29N3O5 — CID 161145771
8-(4-isocyanophenyl)-1,4-dioxa-8-azaspiro[4.5]decane;4-(4-oxopiperidin-1-yl)benzoic acid (PubChem CID 161145771) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 8-(4-isocyanophenyl)-1,4-dioxa-8-azaspiro[4.5]decane;4-(4-oxopiperidin-1-yl)benzoic acid.
| Compound Name | 8-(4-isocyanophenyl)-1,4-dioxa-8-azaspiro[4.5]decane;4-(4-oxopiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 161145771 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 8-(4-isocyanophenyl)-1,4-dioxa-8-azaspiro[4.5]decane;4-(4-oxopiperidin-1-yl)benzoic acid |
| SMILES | O=C1CCN(c2ccc(C(=O)O)cc2)CC1.[C-]#[N+]c1ccc(N2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C14H16N2O2.C12H13NO3/c1-15-12-2-4-13(5-3-12)16-8-6-14(7-9-16)17-10-11-18-14;14-11-5-7-13(8-6-11)10-3-1-9(2-4-10)12(15)16/h2-5H,6-11H2;1-4H,5-8H2,(H,15,16) |
| InChIKey | UOAITODZACPTDU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|