C22H30BBrO4S2 — CID 161147018
5-bromothiophene-2-carbaldehyde;hex-5-enylboronic acid;5-hex-5-enylthiophene-2-carbaldehyde (PubChem CID 161147018) has the molecular formula C22H30BBrO4S2 and a molecular weight of 513.33 g/mol. Its IUPAC name is 5-bromothiophene-2-carbaldehyde;hex-5-enylboronic acid;5-hex-5-enylthiophene-2-carbaldehyde.
| Compound Name | 5-bromothiophene-2-carbaldehyde;hex-5-enylboronic acid;5-hex-5-enylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 161147018 |
| Molecular Formula | C22H30BBrO4S2 |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 5-bromothiophene-2-carbaldehyde;hex-5-enylboronic acid;5-hex-5-enylthiophene-2-carbaldehyde |
| SMILES | C=CCCCCB(O)O.C=CCCCCc1ccc(C=O)s1.O=Cc1ccc(Br)s1 |
| InChI | InChI=1S/C11H14OS.C6H13BO2.C5H3BrOS/c1-2-3-4-5-6-10-7-8-11(9-12)13-10;1-2-3-4-5-6-7(8)9;6-5-2-1-4(3-7)8-5/h2,7-9H,1,3-6H2;2,8-9H,1,3-6H2;1-3H |
| InChIKey | UOEPNIUDLRARQZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|