About oct-7-enylboronic acid
oct-7-enylboronic acid (PubChem CID 53216275) has the molecular formula C8H17BO2
and a molecular weight of 156.03 g/mol. Its IUPAC name is oct-7-enylboronic acid.
Molecular Properties
| Compound Name | oct-7-enylboronic acid |
| PubChem CID | 53216275 |
| Molecular Formula | C8H17BO2 |
| Molecular Weight | 156.03 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | oct-7-enylboronic acid |
| SMILES | C=CCCCCCCB(O)O |
| InChI | InChI=1S/C8H17BO2/c1-2-3-4-5-6-7-8-9(10)11/h2,10-11H,1,3-8H2 |
| InChIKey | NWZXPKHHIAAANV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.03 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-7-enylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-enylboronic acid?
The IUPAC name of oct-7-enylboronic acid (CID 53216275) is oct-7-enylboronic acid.
What is the SMILES notation for oct-7-enylboronic acid?
The canonical SMILES for oct-7-enylboronic acid is C=CCCCCCCB(O)O.
What is the InChIKey of oct-7-enylboronic acid?
The InChIKey is NWZXPKHHIAAANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BO2/c1-2-3-4-5-6-7-8-9(10)11/h2,10-11H,1,3-8H2.
What are the key properties of oct-7-enylboronic acid?
oct-7-enylboronic acid has a molecular weight of 156.03 g/mol, XLogP of 1.60, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-enylboronic acid is sourced from PubChem (CID 53216275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).