C7H15NOS — CID 161151599
2-methylpropane;1,3-oxazolidine-2-thione (PubChem CID 161151599) has the molecular formula C7H15NOS and a molecular weight of 161.27 g/mol. Its IUPAC name is 2-methylpropane;1,3-oxazolidine-2-thione.
| Compound Name | 2-methylpropane;1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 161151599 |
| Molecular Formula | C7H15NOS |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 2-methylpropane;1,3-oxazolidine-2-thione |
| SMILES | CC(C)C.S=C1NCCO1 |
| InChI | InChI=1S/C4H10.C3H5NOS/c1-4(2)3;6-3-4-1-2-5-3/h4H,1-3H3;1-2H2,(H,4,6) |
| InChIKey | UOTFNBUQZIOOAS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|