C39H40O4P2 — CID 161158895
diphenylphosphorylmethylbenzene;diphenylphosphorylmethyl 2-methylprop-2-enoate;prop-1-ene (PubChem CID 161158895) has the molecular formula C39H40O4P2 and a molecular weight of 634.69 g/mol. Its IUPAC name is diphenylphosphorylmethylbenzene;diphenylphosphorylmethyl 2-methylprop-2-enoate;prop-1-ene.
| Compound Name | diphenylphosphorylmethylbenzene;diphenylphosphorylmethyl 2-methylprop-2-enoate;prop-1-ene |
|---|---|
| PubChem CID | 161158895 |
| Molecular Formula | C39H40O4P2 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | diphenylphosphorylmethylbenzene;diphenylphosphorylmethyl 2-methylprop-2-enoate;prop-1-ene |
| SMILES | C=C(C)C(=O)OCP(=O)(c1ccccc1)c1ccccc1.C=CC.O=P(Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17OP.C17H17O3P.C3H6/c20-21(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17;1-14(2)17(18)20-13-21(19,15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-3-2/h1-15H,16H2;3-12H,1,13H2,2H3;3H,1H2,2H3 |
| InChIKey | UPQXFUSFOLDZON-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|