About lithium;carbonic acid;trifluoro(methanidyloxy)methane
lithium;carbonic acid;trifluoro(methanidyloxy)methane (PubChem CID 161160982) has the molecular formula C3H4F3LiO4
and a molecular weight of 168.00 g/mol. Its IUPAC name is lithium;carbonic acid;trifluoro(methanidyloxy)methane.
Molecular Properties
| Compound Name | lithium;carbonic acid;trifluoro(methanidyloxy)methane |
| PubChem CID | 161160982 |
| Molecular Formula | C3H4F3LiO4 |
| Molecular Weight | 168.00 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | lithium;carbonic acid;trifluoro(methanidyloxy)methane |
| SMILES | O=C(O)O.[CH2-]OC(F)(F)F.[Li+] |
| InChI | InChI=1S/C2H2F3O.CH2O3.Li/c1-6-2(3,4)5;2-1(3)4;/h1H2;(H2,2,3,4);/q-1;;+1 |
| InChIKey | NYDBIJOEHMEEJF-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.00 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;carbonic acid;trifluoro(methanidyloxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;carbonic acid;trifluoro(methanidyloxy)methane?
The IUPAC name of lithium;carbonic acid;trifluoro(methanidyloxy)methane (CID 161160982) is lithium;carbonic acid;trifluoro(methanidyloxy)methane.
What is the SMILES notation for lithium;carbonic acid;trifluoro(methanidyloxy)methane?
The canonical SMILES for lithium;carbonic acid;trifluoro(methanidyloxy)methane is O=C(O)O.[CH2-]OC(F)(F)F.[Li+].
What is the InChIKey of lithium;carbonic acid;trifluoro(methanidyloxy)methane?
The InChIKey is NYDBIJOEHMEEJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F3O.CH2O3.Li/c1-6-2(3,4)5;2-1(3)4;/h1H2;(H2,2,3,4);/q-1;;+1.
What are the key properties of lithium;carbonic acid;trifluoro(methanidyloxy)methane?
lithium;carbonic acid;trifluoro(methanidyloxy)methane has a molecular weight of 168.00 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;carbonic acid;trifluoro(methanidyloxy)methane is sourced from PubChem (CID 161160982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).