About 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal
2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal (PubChem CID 161164097) has the molecular formula C14H28N4O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal.
Molecular Properties
| Compound Name | 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal |
| PubChem CID | 161164097 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal |
| SMILES | C/N=C(\C)C(CC=O)NC.C/N=C(\C)CC(C=O)NC |
| InChI | InChI=1S/2C7H14N2O/c1-6(8-2)4-7(5-10)9-3;1-6(8-2)7(9-3)4-5-10/h2*5,7,9H,4H2,1-3H3/b2*8-6+ |
| InChIKey | UQHKHMRISZVMEX-QBIWIAABSA-N |
| XLogP | 0.51 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal?
The IUPAC name of 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal (CID 161164097) is 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal.
What is the SMILES notation for 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal?
The canonical SMILES for 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal is C/N=C(\C)C(CC=O)NC.C/N=C(\C)CC(C=O)NC.
What is the InChIKey of 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal?
The InChIKey is UQHKHMRISZVMEX-QBIWIAABSA-N. The full InChI is InChI=1S/2C7H14N2O/c1-6(8-2)4-7(5-10)9-3;1-6(8-2)7(9-3)4-5-10/h2*5,7,9H,4H2,1-3H3/b2*8-6+.
What are the key properties of 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal?
2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal has a molecular weight of 284.40 g/mol, XLogP of 0.51, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-4-methyliminopentanal;3-(methylamino)-4-methyliminopentanal is sourced from PubChem (CID 161164097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).