C18H45N3O6 — CID 178167308
ethane;2-(methylamino)pentanedial;bis(2-(methylamino)propane-1,3-diol) (PubChem CID 178167308) has the molecular formula C18H45N3O6 and a molecular weight of 399.57 g/mol. Its IUPAC name is ethane;2-(methylamino)pentanedial;bis(2-(methylamino)propane-1,3-diol).
| Compound Name | ethane;2-(methylamino)pentanedial;bis(2-(methylamino)propane-1,3-diol) |
|---|---|
| PubChem CID | 178167308 |
| Molecular Formula | C18H45N3O6 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | ethane;2-(methylamino)pentanedial;bis(2-(methylamino)propane-1,3-diol) |
| SMILES | CC.CC.CNC(C=O)CCC=O.CNC(CO)CO.CNC(CO)CO |
| InChI | InChI=1S/C6H11NO2.2C4H11NO2.2C2H6/c1-7-6(5-9)3-2-4-8;2*1-5-4(2-6)3-7;2*1-2/h4-7H,2-3H2,1H3;2*4-7H,2-3H2,1H3;2*1-2H3 |
| InChIKey | GCSNPMUNXKKMTA-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|