C9H16N2O3 — CID 169158983
4-(1,5-dioxopentan-2-ylamino)butanamide (PubChem CID 169158983) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(1,5-dioxopentan-2-ylamino)butanamide.
| Compound Name | 4-(1,5-dioxopentan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 169158983 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 4-(1,5-dioxopentan-2-ylamino)butanamide |
| SMILES | NC(=O)CCCNC(C=O)CCC=O |
| InChI | InChI=1S/C9H16N2O3/c10-9(14)4-1-5-11-8(7-13)3-2-6-12/h6-8,11H,1-5H2,(H2,10,14) |
| InChIKey | KXCWIORIZJDYNK-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|