About 5-formyl-6-oxohexanamide
5-formyl-6-oxohexanamide (PubChem CID 140570423) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-formyl-6-oxohexanamide.
Molecular Properties
| Compound Name | 5-formyl-6-oxohexanamide |
| PubChem CID | 140570423 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-formyl-6-oxohexanamide |
| SMILES | NC(=O)CCCC(C=O)C=O |
| InChI | InChI=1S/C7H11NO3/c8-7(11)3-1-2-6(4-9)5-10/h4-6H,1-3H2,(H2,8,11) |
| InChIKey | UNNPOXUVOPFEEE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-formyl-6-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formyl-6-oxohexanamide?
The IUPAC name of 5-formyl-6-oxohexanamide (CID 140570423) is 5-formyl-6-oxohexanamide.
What is the SMILES notation for 5-formyl-6-oxohexanamide?
The canonical SMILES for 5-formyl-6-oxohexanamide is NC(=O)CCCC(C=O)C=O.
What is the InChIKey of 5-formyl-6-oxohexanamide?
The InChIKey is UNNPOXUVOPFEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c8-7(11)3-1-2-6(4-9)5-10/h4-6H,1-3H2,(H2,8,11).
What are the key properties of 5-formyl-6-oxohexanamide?
5-formyl-6-oxohexanamide has a molecular weight of 157.17 g/mol, XLogP of -0.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyl-6-oxohexanamide is sourced from PubChem (CID 140570423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).