C10H26N4O — CID 177242165
ethane;methanamine;N'-[4-(methylamino)-5-oxopentyl]methanimidamide (PubChem CID 177242165) has the molecular formula C10H26N4O and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;methanamine;N'-[4-(methylamino)-5-oxopentyl]methanimidamide.
| Compound Name | ethane;methanamine;N'-[4-(methylamino)-5-oxopentyl]methanimidamide |
|---|---|
| PubChem CID | 177242165 |
| Molecular Formula | C10H26N4O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.21 |
| IUPAC Name | ethane;methanamine;N'-[4-(methylamino)-5-oxopentyl]methanimidamide |
| SMILES | CC.CN.CNC(C=O)CCC/N=C/N |
| InChI | InChI=1S/C7H15N3O.C2H6.CH5N/c1-9-7(5-11)3-2-4-10-6-8;2*1-2/h5-7,9H,2-4H2,1H3,(H2,8,10);1-2H3;2H2,1H3 |
| InChIKey | IINHBJAMGMMGKZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|