C14H30N4O — CID 171080465
6-amino-2-[[7-amino-3-(methylamino)hept-1-en-2-yl]amino]hexanal (PubChem CID 171080465) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is 6-amino-2-[[7-amino-3-(methylamino)hept-1-en-2-yl]amino]hexanal.
| Compound Name | 6-amino-2-[[7-amino-3-(methylamino)hept-1-en-2-yl]amino]hexanal |
|---|---|
| PubChem CID | 171080465 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 6-amino-2-[[7-amino-3-(methylamino)hept-1-en-2-yl]amino]hexanal |
| SMILES | C=C(NC(C=O)CCCCN)C(CCCCN)NC |
| InChI | InChI=1S/C14H30N4O/c1-12(14(17-2)8-4-6-10-16)18-13(11-19)7-3-5-9-15/h11,13-14,17-18H,1,3-10,15-16H2,2H3 |
| InChIKey | GFRVEMQEICLLDI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|