C10H18N4O3 — CID 171544598
N-[6-(aminomethylideneamino)-2-oxohexan-3-yl]-2-formamidoacetamide (PubChem CID 171544598) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[6-(aminomethylideneamino)-2-oxohexan-3-yl]-2-formamidoacetamide.
| Compound Name | N-[6-(aminomethylideneamino)-2-oxohexan-3-yl]-2-formamidoacetamide |
|---|---|
| PubChem CID | 171544598 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-[6-(aminomethylideneamino)-2-oxohexan-3-yl]-2-formamidoacetamide |
| SMILES | CC(=O)C(CCC/N=C/N)NC(=O)CNC=O |
| InChI | InChI=1S/C10H18N4O3/c1-8(16)9(3-2-4-12-6-11)14-10(17)5-13-7-15/h6-7,9H,2-5H2,1H3,(H2,11,12)(H,13,15)(H,14,17) |
| InChIKey | HWLUSWAHRBYDDU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|